N-(4-chlorophenyl)-4-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-4-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
N-(4-chlorophenyl)-4-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M100-0031 |
| Compound Name: | N-(4-chlorophenyl)-4-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 367.83 |
| Molecular Formula: | C14 H10 Cl N3 O3 S2 |
| Smiles: | C1=CC(NN=C1c1cc(sc1)S(Nc1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4058 |
| logD: | 3.2651 |
| logSw: | -3.9671 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.044 |
| InChI Key: | RGTFFFLONZVMOH-UHFFFAOYSA-N |