2-methyl-6-[5-(4-methylpiperazine-1-sulfonyl)thiophen-3-yl]pyridazin-3(2H)-one
Chemical Structure Depiction of
2-methyl-6-[5-(4-methylpiperazine-1-sulfonyl)thiophen-3-yl]pyridazin-3(2H)-one
2-methyl-6-[5-(4-methylpiperazine-1-sulfonyl)thiophen-3-yl]pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | M100-0428 |
| Compound Name: | 2-methyl-6-[5-(4-methylpiperazine-1-sulfonyl)thiophen-3-yl]pyridazin-3(2H)-one |
| Molecular Weight: | 354.45 |
| Molecular Formula: | C14 H18 N4 O3 S2 |
| Smiles: | CN1CCN(CC1)S(c1cc(cs1)C1C=CC(N(C)N=1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.6971 |
| logD: | 0.6087 |
| logSw: | -1.6106 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.704 |
| InChI Key: | BAZJIJXDLGWYFQ-UHFFFAOYSA-N |