N-(5-chloropyridin-2-yl)-4-(1-ethyl-6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(5-chloropyridin-2-yl)-4-(1-ethyl-6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
N-(5-chloropyridin-2-yl)-4-(1-ethyl-6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M100-0651 |
| Compound Name: | N-(5-chloropyridin-2-yl)-4-(1-ethyl-6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 396.87 |
| Molecular Formula: | C15 H13 Cl N4 O3 S2 |
| Smiles: | CCN1C(C=CC(c2cc(sc2)S(Nc2ccc(cn2)[Cl])(=O)=O)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9315 |
| logD: | 1.4283 |
| logSw: | -3.6253 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.916 |
| InChI Key: | KMCWTCNIQYXMOJ-UHFFFAOYSA-N |