N-(2-chlorophenyl)-2-[3-(3-methylphenyl)-7-oxo[1,2]thiazolo[4,5-d]pyrimidin-6(7H)-yl]acetamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-2-[3-(3-methylphenyl)-7-oxo[1,2]thiazolo[4,5-d]pyrimidin-6(7H)-yl]acetamide
N-(2-chlorophenyl)-2-[3-(3-methylphenyl)-7-oxo[1,2]thiazolo[4,5-d]pyrimidin-6(7H)-yl]acetamide
Compound characteristics
| Compound ID: | M108-0278 |
| Compound Name: | N-(2-chlorophenyl)-2-[3-(3-methylphenyl)-7-oxo[1,2]thiazolo[4,5-d]pyrimidin-6(7H)-yl]acetamide |
| Molecular Weight: | 410.88 |
| Molecular Formula: | C20 H15 Cl N4 O2 S |
| Smiles: | Cc1cccc(c1)c1c2c(C(N(CC(Nc3ccccc3[Cl])=O)C=N2)=O)sn1 |
| Stereo: | ACHIRAL |
| logP: | 3.5369 |
| logD: | 3.5368 |
| logSw: | -3.7541 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.529 |
| InChI Key: | MYKXXWLDOQZLIO-UHFFFAOYSA-N |