N-(3,4-dimethylphenyl)-2-[(6-ethyl-7-oxo-3-phenyl-6,7-dihydro[1,2]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-2-[(6-ethyl-7-oxo-3-phenyl-6,7-dihydro[1,2]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide
N-(3,4-dimethylphenyl)-2-[(6-ethyl-7-oxo-3-phenyl-6,7-dihydro[1,2]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | M109-0516 |
| Compound Name: | N-(3,4-dimethylphenyl)-2-[(6-ethyl-7-oxo-3-phenyl-6,7-dihydro[1,2]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide |
| Molecular Weight: | 450.58 |
| Molecular Formula: | C23 H22 N4 O2 S2 |
| Smiles: | CCN1C(=Nc2c(c3ccccc3)nsc2C1=O)SCC(Nc1ccc(C)c(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0144 |
| logD: | 5.0144 |
| logSw: | -4.5878 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.655 |
| InChI Key: | YNZWCLUVPIHYSZ-UHFFFAOYSA-N |