1-[3-(methylsulfanyl)phenyl]-3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}pyridazin-4(1H)-one
Chemical Structure Depiction of
1-[3-(methylsulfanyl)phenyl]-3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}pyridazin-4(1H)-one
1-[3-(methylsulfanyl)phenyl]-3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}pyridazin-4(1H)-one
Compound characteristics
| Compound ID: | M115-0765 |
| Compound Name: | 1-[3-(methylsulfanyl)phenyl]-3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}pyridazin-4(1H)-one |
| Molecular Weight: | 408.5 |
| Molecular Formula: | C20 H16 N4 O2 S2 |
| Smiles: | CSc1ccc(cc1)c1nc(C2C(C=CN(c3cccc(c3)SC)N=2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9226 |
| logD: | 4.9226 |
| logSw: | -4.7627 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.055 |
| InChI Key: | CLCLNBFKOAQTPN-UHFFFAOYSA-N |