1-(3-fluorophenyl)-3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridazin-4(1H)-one
Chemical Structure Depiction of
1-(3-fluorophenyl)-3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridazin-4(1H)-one
1-(3-fluorophenyl)-3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridazin-4(1H)-one
Compound characteristics
| Compound ID: | M115-1141 |
| Compound Name: | 1-(3-fluorophenyl)-3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyridazin-4(1H)-one |
| Molecular Weight: | 352.3 |
| Molecular Formula: | C18 H10 F2 N4 O2 |
| Smiles: | C1=CN(c2cccc(c2)F)N=C(C1=O)c1nc(c2cccc(c2)F)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.9714 |
| logD: | 3.9714 |
| logSw: | -4.2333 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.055 |
| InChI Key: | NSTWKIFDAGCVFW-UHFFFAOYSA-N |