3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(3,4-difluorophenyl)pyridazin-4(1H)-one
Chemical Structure Depiction of
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(3,4-difluorophenyl)pyridazin-4(1H)-one
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(3,4-difluorophenyl)pyridazin-4(1H)-one
Compound characteristics
| Compound ID: | M115-1262 |
| Compound Name: | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(3,4-difluorophenyl)pyridazin-4(1H)-one |
| Molecular Weight: | 386.74 |
| Molecular Formula: | C18 H9 Cl F2 N4 O2 |
| Smiles: | C1=CN(c2ccc(c(c2)F)F)N=C(C1=O)c1nc(c2ccc(cc2)[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7377 |
| logD: | 4.7377 |
| logSw: | -5.1205 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.055 |
| InChI Key: | HMIUTXWACIMGLA-UHFFFAOYSA-N |