4-{[2,3-dioxo-4-(propan-2-yl)piperazin-1-yl]methyl}-N-[(3-methoxyphenyl)methyl]benzamide
Chemical Structure Depiction of
4-{[2,3-dioxo-4-(propan-2-yl)piperazin-1-yl]methyl}-N-[(3-methoxyphenyl)methyl]benzamide
4-{[2,3-dioxo-4-(propan-2-yl)piperazin-1-yl]methyl}-N-[(3-methoxyphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | M116-0631 |
| Compound Name: | 4-{[2,3-dioxo-4-(propan-2-yl)piperazin-1-yl]methyl}-N-[(3-methoxyphenyl)methyl]benzamide |
| Molecular Weight: | 409.48 |
| Molecular Formula: | C23 H27 N3 O4 |
| Smiles: | CC(C)N1CCN(Cc2ccc(cc2)C(NCc2cccc(c2)OC)=O)C(C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1504 |
| logD: | 2.1504 |
| logSw: | -2.7281 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.398 |
| InChI Key: | ZIVTZMLWRKQPRQ-UHFFFAOYSA-N |