1-[(4-fluorophenyl)methyl]-4-{[4-(piperidine-1-carbonyl)phenyl]methyl}piperazine-2,3-dione
Chemical Structure Depiction of
1-[(4-fluorophenyl)methyl]-4-{[4-(piperidine-1-carbonyl)phenyl]methyl}piperazine-2,3-dione
1-[(4-fluorophenyl)methyl]-4-{[4-(piperidine-1-carbonyl)phenyl]methyl}piperazine-2,3-dione
Compound characteristics
| Compound ID: | M116-2307 |
| Compound Name: | 1-[(4-fluorophenyl)methyl]-4-{[4-(piperidine-1-carbonyl)phenyl]methyl}piperazine-2,3-dione |
| Molecular Weight: | 423.49 |
| Molecular Formula: | C24 H26 F N3 O3 |
| Smiles: | C1CCN(CC1)C(c1ccc(CN2CCN(Cc3ccc(cc3)F)C(C2=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.055 |
| logD: | 2.055 |
| logSw: | -2.4239 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.932 |
| InChI Key: | UCEVKWTXLVKTNR-UHFFFAOYSA-N |