4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-N-(4-ethylphenyl)benzamide
Chemical Structure Depiction of
4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-N-(4-ethylphenyl)benzamide
4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-N-(4-ethylphenyl)benzamide
Compound characteristics
| Compound ID: | M116-2833 |
| Compound Name: | 4-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-N-(4-ethylphenyl)benzamide |
| Molecular Weight: | 379.46 |
| Molecular Formula: | C22 H25 N3 O3 |
| Smiles: | CCc1ccc(cc1)NC(c1ccc(CN2CCN(CC)C(C2=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.89 |
| logD: | 2.8899 |
| logSw: | -3.3169 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.371 |
| InChI Key: | QEAVUQPCFDRSRR-UHFFFAOYSA-N |