methyl 2-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxylate
Chemical Structure Depiction of
methyl 2-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxylate
methyl 2-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxylate
Compound characteristics
| Compound ID: | M124-0058 |
| Compound Name: | methyl 2-[4-(2-fluorophenyl)piperazin-1-yl]-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxylate |
| Molecular Weight: | 458.49 |
| Molecular Formula: | C26 H23 F N4 O3 |
| Smiles: | COC(c1ccc2C(N(C(=Nc2c1)N1CCN(CC1)c1ccccc1F)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9639 |
| logD: | 3.9638 |
| logSw: | -4.1584 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.344 |
| InChI Key: | KUUHWIWCDRKILV-UHFFFAOYSA-N |