methyl 2-(4-benzylpiperazin-1-yl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Chemical Structure Depiction of
methyl 2-(4-benzylpiperazin-1-yl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
methyl 2-(4-benzylpiperazin-1-yl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Compound characteristics
| Compound ID: | M124-0226 |
| Compound Name: | methyl 2-(4-benzylpiperazin-1-yl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate |
| Molecular Weight: | 484.55 |
| Molecular Formula: | C28 H28 N4 O4 |
| Smiles: | COC(c1ccc2C(N(C(=Nc2c1)N1CCN(CC1)Cc1ccccc1)c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7518 |
| logD: | 2.9904 |
| logSw: | -4.0165 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.469 |
| InChI Key: | JXTZMVVZIMBHAC-UHFFFAOYSA-N |