methyl 3-(3-chlorophenyl)-4-oxo-2-(thiomorpholin-4-yl)-3,4-dihydroquinazoline-7-carboxylate
Chemical Structure Depiction of
methyl 3-(3-chlorophenyl)-4-oxo-2-(thiomorpholin-4-yl)-3,4-dihydroquinazoline-7-carboxylate
methyl 3-(3-chlorophenyl)-4-oxo-2-(thiomorpholin-4-yl)-3,4-dihydroquinazoline-7-carboxylate
Compound characteristics
| Compound ID: | M124-0541 |
| Compound Name: | methyl 3-(3-chlorophenyl)-4-oxo-2-(thiomorpholin-4-yl)-3,4-dihydroquinazoline-7-carboxylate |
| Molecular Weight: | 415.9 |
| Molecular Formula: | C20 H18 Cl N3 O3 S |
| Smiles: | COC(c1ccc2C(N(C(=Nc2c1)N1CCSCC1)c1cccc(c1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3359 |
| logD: | 3.3359 |
| logSw: | -3.7441 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.385 |
| InChI Key: | ONKUCKRKPBIVNV-UHFFFAOYSA-N |