methyl 2-(4-ethylpiperazin-1-yl)-3-(3-fluoro-4-methylphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Chemical Structure Depiction of
methyl 2-(4-ethylpiperazin-1-yl)-3-(3-fluoro-4-methylphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
methyl 2-(4-ethylpiperazin-1-yl)-3-(3-fluoro-4-methylphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Compound characteristics
| Compound ID: | M124-0604 |
| Compound Name: | methyl 2-(4-ethylpiperazin-1-yl)-3-(3-fluoro-4-methylphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylate |
| Molecular Weight: | 424.47 |
| Molecular Formula: | C23 H25 F N4 O3 |
| Smiles: | CCN1CCN(CC1)C1=Nc2cc(ccc2C(N1c1ccc(C)c(c1)F)=O)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.0956 |
| logD: | 1.2689 |
| logSw: | -3.1521 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.922 |
| InChI Key: | XDZNNGUBPDURSX-UHFFFAOYSA-N |