methyl 2-(azepan-1-yl)-3-[(4-methoxyphenyl)methyl]-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Chemical Structure Depiction of
methyl 2-(azepan-1-yl)-3-[(4-methoxyphenyl)methyl]-4-oxo-3,4-dihydroquinazoline-7-carboxylate
methyl 2-(azepan-1-yl)-3-[(4-methoxyphenyl)methyl]-4-oxo-3,4-dihydroquinazoline-7-carboxylate
Compound characteristics
| Compound ID: | M124-0909 |
| Compound Name: | methyl 2-(azepan-1-yl)-3-[(4-methoxyphenyl)methyl]-4-oxo-3,4-dihydroquinazoline-7-carboxylate |
| Molecular Weight: | 421.5 |
| Molecular Formula: | C24 H27 N3 O4 |
| Smiles: | COC(c1ccc2C(N(Cc3ccc(cc3)OC)C(=Nc2c1)N1CCCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3412 |
| logD: | 4.3412 |
| logSw: | -4.2591 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.871 |
| InChI Key: | JSDHXUZNXZMPFS-UHFFFAOYSA-N |