2-(dimethylamino)-N-ethyl-3-(4-fluorophenyl)-3H-thieno[2,3-d]imidazole-5-carboxamide
Chemical Structure Depiction of
2-(dimethylamino)-N-ethyl-3-(4-fluorophenyl)-3H-thieno[2,3-d]imidazole-5-carboxamide
2-(dimethylamino)-N-ethyl-3-(4-fluorophenyl)-3H-thieno[2,3-d]imidazole-5-carboxamide
Compound characteristics
| Compound ID: | M151-0577 |
| Compound Name: | 2-(dimethylamino)-N-ethyl-3-(4-fluorophenyl)-3H-thieno[2,3-d]imidazole-5-carboxamide |
| Molecular Weight: | 332.4 |
| Molecular Formula: | C16 H17 F N4 O S |
| Smiles: | CCNC(c1cc2c(n(c3ccc(cc3)F)c(n2)N(C)C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0404 |
| logD: | 2.9704 |
| logSw: | -3.3348 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.42 |
| InChI Key: | DIWQDQNQTPDLAF-UHFFFAOYSA-N |