N-benzyl-2-[(6-{[(4-chlorophenyl)methyl]amino}pyrimidin-4-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-benzyl-2-[(6-{[(4-chlorophenyl)methyl]amino}pyrimidin-4-yl)sulfanyl]acetamide
N-benzyl-2-[(6-{[(4-chlorophenyl)methyl]amino}pyrimidin-4-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | M179-4019 |
| Compound Name: | N-benzyl-2-[(6-{[(4-chlorophenyl)methyl]amino}pyrimidin-4-yl)sulfanyl]acetamide |
| Molecular Weight: | 398.91 |
| Molecular Formula: | C20 H19 Cl N4 O S |
| Smiles: | C(c1ccccc1)NC(CSc1cc(NCc2ccc(cc2)[Cl])ncn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9225 |
| logD: | 3.9223 |
| logSw: | -4.4135 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.411 |
| InChI Key: | IUIAFZNJCOZCOQ-UHFFFAOYSA-N |