N-(2,4-dimethylphenyl)-2-({6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-({6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)acetamide
N-(2,4-dimethylphenyl)-2-({6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)acetamide
Compound characteristics
| Compound ID: | M180-0505 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-({6-methyl-2-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)acetamide |
| Molecular Weight: | 415.41 |
| Molecular Formula: | C22 H20 F3 N3 O2 |
| Smiles: | Cc1ccc(c(C)c1)NC(COc1cc(C)nc(c2ccc(cc2)C(F)(F)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9095 |
| logD: | 5.9094 |
| logSw: | -5.4504 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.924 |
| InChI Key: | YTTPDMNUPMHECP-UHFFFAOYSA-N |