N-(2-fluoro-4-methylphenyl)-2-[1-oxo-4-(pyrrolidin-1-yl)phthalazin-2(1H)-yl]acetamide
Chemical Structure Depiction of
N-(2-fluoro-4-methylphenyl)-2-[1-oxo-4-(pyrrolidin-1-yl)phthalazin-2(1H)-yl]acetamide
N-(2-fluoro-4-methylphenyl)-2-[1-oxo-4-(pyrrolidin-1-yl)phthalazin-2(1H)-yl]acetamide
Compound characteristics
| Compound ID: | M183-0276 |
| Compound Name: | N-(2-fluoro-4-methylphenyl)-2-[1-oxo-4-(pyrrolidin-1-yl)phthalazin-2(1H)-yl]acetamide |
| Molecular Weight: | 380.42 |
| Molecular Formula: | C21 H21 F N4 O2 |
| Smiles: | Cc1ccc(c(c1)F)NC(CN1C(c2ccccc2C(=N1)N1CCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2018 |
| logD: | 3.2017 |
| logSw: | -3.4969 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.055 |
| InChI Key: | YEZKLFBWXAZGEH-UHFFFAOYSA-N |