N-(2,4-dimethylphenyl)-2-[4-(morpholin-4-yl)-1-oxophthalazin-2(1H)-yl]acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-[4-(morpholin-4-yl)-1-oxophthalazin-2(1H)-yl]acetamide
N-(2,4-dimethylphenyl)-2-[4-(morpholin-4-yl)-1-oxophthalazin-2(1H)-yl]acetamide
Compound characteristics
| Compound ID: | M183-0440 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-[4-(morpholin-4-yl)-1-oxophthalazin-2(1H)-yl]acetamide |
| Molecular Weight: | 392.46 |
| Molecular Formula: | C22 H24 N4 O3 |
| Smiles: | Cc1ccc(c(C)c1)NC(CN1C(c2ccccc2C(=N1)N1CCOCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4367 |
| logD: | 2.4367 |
| logSw: | -3.0233 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.597 |
| InChI Key: | SSZGBXPLFLYPBO-UHFFFAOYSA-N |