N-(3-chlorophenyl)-3-[1-(4-ethoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-amine
Chemical Structure Depiction of
N-(3-chlorophenyl)-3-[1-(4-ethoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-amine
N-(3-chlorophenyl)-3-[1-(4-ethoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-amine
Compound characteristics
| Compound ID: | M213-0137 |
| Compound Name: | N-(3-chlorophenyl)-3-[1-(4-ethoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-amine |
| Molecular Weight: | 412.9 |
| Molecular Formula: | C19 H17 Cl N6 O S |
| Smiles: | CCOc1ccc(cc1)n1c(C)c(c2nc(Nc3cccc(c3)[Cl])sn2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 5.3016 |
| logD: | 5.3016 |
| logSw: | -5.7981 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.705 |
| InChI Key: | GWMUHFVJXQRJES-UHFFFAOYSA-N |