3-[1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-N-(4-methoxyphenyl)-1,2,4-thiadiazol-5-amine
Chemical Structure Depiction of
3-[1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-N-(4-methoxyphenyl)-1,2,4-thiadiazol-5-amine
3-[1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-N-(4-methoxyphenyl)-1,2,4-thiadiazol-5-amine
Compound characteristics
| Compound ID: | M213-0331 |
| Compound Name: | 3-[1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-N-(4-methoxyphenyl)-1,2,4-thiadiazol-5-amine |
| Molecular Weight: | 382.42 |
| Molecular Formula: | C18 H15 F N6 O S |
| Smiles: | Cc1c(c2nc(Nc3ccc(cc3)OC)sn2)nnn1c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.1905 |
| logD: | 4.1905 |
| logSw: | -4.3258 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.125 |
| InChI Key: | ZPQAMKQFDKTZCI-UHFFFAOYSA-N |