N-(3,5-difluorophenyl)-5-methoxypyridine-3-carboxamide
Chemical Structure Depiction of
N-(3,5-difluorophenyl)-5-methoxypyridine-3-carboxamide
N-(3,5-difluorophenyl)-5-methoxypyridine-3-carboxamide
Compound characteristics
| Compound ID: | M300-0525 |
| Compound Name: | N-(3,5-difluorophenyl)-5-methoxypyridine-3-carboxamide |
| Molecular Weight: | 264.23 |
| Molecular Formula: | C13 H10 F2 N2 O2 |
| Smiles: | COc1cc(cnc1)C(Nc1cc(cc(c1)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5761 |
| logD: | 2.4062 |
| logSw: | -2.7164 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.481 |
| InChI Key: | RCZVMXYUDDQEIY-UHFFFAOYSA-N |