N-(4-ethoxyphenyl)-3-[1-(4-methylbenzene-1-sulfonyl)piperidin-3-yl]propanamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-3-[1-(4-methylbenzene-1-sulfonyl)piperidin-3-yl]propanamide
N-(4-ethoxyphenyl)-3-[1-(4-methylbenzene-1-sulfonyl)piperidin-3-yl]propanamide
Compound characteristics
| Compound ID: | M305-0047 |
| Compound Name: | N-(4-ethoxyphenyl)-3-[1-(4-methylbenzene-1-sulfonyl)piperidin-3-yl]propanamide |
| Molecular Weight: | 430.57 |
| Molecular Formula: | C23 H30 N2 O4 S |
| Smiles: | CCOc1ccc(cc1)NC(CCC1CCCN(C1)S(c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3817 |
| logD: | 4.3817 |
| logSw: | -4.0758 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.884 |
| InChI Key: | KNIGNYTZFWOVNA-LJQANCHMSA-N |