3-[1-(benzenesulfonyl)piperidin-3-yl]-N-[(pyridin-4-yl)methyl]propanamide
Chemical Structure Depiction of
3-[1-(benzenesulfonyl)piperidin-3-yl]-N-[(pyridin-4-yl)methyl]propanamide
3-[1-(benzenesulfonyl)piperidin-3-yl]-N-[(pyridin-4-yl)methyl]propanamide
Compound characteristics
| Compound ID: | M305-0966 |
| Compound Name: | 3-[1-(benzenesulfonyl)piperidin-3-yl]-N-[(pyridin-4-yl)methyl]propanamide |
| Molecular Weight: | 387.5 |
| Molecular Formula: | C20 H25 N3 O3 S |
| Smiles: | C1CC(CCC(NCc2ccncc2)=O)CN(C1)S(c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.748 |
| logD: | 1.7447 |
| logSw: | -2.1713 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.511 |
| InChI Key: | QCROENHDFCXPLU-GOSISDBHSA-N |