3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(3,5-dimethoxyphenyl)propanamide
Chemical Structure Depiction of
3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(3,5-dimethoxyphenyl)propanamide
3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(3,5-dimethoxyphenyl)propanamide
Compound characteristics
| Compound ID: | M305-1066 |
| Compound Name: | 3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(3,5-dimethoxyphenyl)propanamide |
| Molecular Weight: | 432.54 |
| Molecular Formula: | C22 H28 N2 O5 S |
| Smiles: | COc1cc(cc(c1)OC)NC(CCC1CCCN(C1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5434 |
| logD: | 3.5431 |
| logSw: | -4.0248 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.848 |
| InChI Key: | FIOCZWGFOKQRON-QGZVFWFLSA-N |