3-(3-{[(2-methoxyphenyl)methyl]amino}-3-oxopropyl)-N-phenylpiperidine-1-carboxamide
Chemical Structure Depiction of
3-(3-{[(2-methoxyphenyl)methyl]amino}-3-oxopropyl)-N-phenylpiperidine-1-carboxamide
3-(3-{[(2-methoxyphenyl)methyl]amino}-3-oxopropyl)-N-phenylpiperidine-1-carboxamide
Compound characteristics
| Compound ID: | M308-0944 |
| Compound Name: | 3-(3-{[(2-methoxyphenyl)methyl]amino}-3-oxopropyl)-N-phenylpiperidine-1-carboxamide |
| Molecular Weight: | 395.5 |
| Molecular Formula: | C23 H29 N3 O3 |
| Smiles: | [H]N(C(N1CCCC(CCC(NCc2ccccc2OC)=O)C1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.562 |
| logD: | 3.562 |
| logSw: | -3.7851 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.471 |
| InChI Key: | FDSYXQKSHQNUIO-GOSISDBHSA-N |