N-(3-methyl-5-{2-[5-(propylsulfamoyl)thiophen-2-yl]ethenyl}-1,2-oxazol-4-yl)acetamide
Chemical Structure Depiction of
N-(3-methyl-5-{2-[5-(propylsulfamoyl)thiophen-2-yl]ethenyl}-1,2-oxazol-4-yl)acetamide
N-(3-methyl-5-{2-[5-(propylsulfamoyl)thiophen-2-yl]ethenyl}-1,2-oxazol-4-yl)acetamide
Compound characteristics
| Compound ID: | M331-0097 |
| Compound Name: | N-(3-methyl-5-{2-[5-(propylsulfamoyl)thiophen-2-yl]ethenyl}-1,2-oxazol-4-yl)acetamide |
| Molecular Weight: | 369.46 |
| Molecular Formula: | C15 H19 N3 O4 S2 |
| Smiles: | CCCNS(c1ccc(/C=C/c2c(c(C)no2)NC(C)=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5018 |
| logD: | 1.5015 |
| logSw: | -2.3864 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.51 |
| InChI Key: | KEZWBJPPLBXDHC-UHFFFAOYSA-N |