N-[3-methyl-5-(2-{5-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
Chemical Structure Depiction of
N-[3-methyl-5-(2-{5-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
N-[3-methyl-5-(2-{5-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
Compound characteristics
| Compound ID: | M331-0461 |
| Compound Name: | N-[3-methyl-5-(2-{5-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide |
| Molecular Weight: | 471.6 |
| Molecular Formula: | C23 H25 N3 O4 S2 |
| Smiles: | CCC(Nc1c(C)noc1/C=C/c1ccc(s1)S(NC1CCCc2ccccc12)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9924 |
| logD: | 3.9894 |
| logSw: | -3.9846 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.342 |
| InChI Key: | GFEDVYZJAYDMFH-IBGZPJMESA-N |