N-[3-methyl-5-(2-{5-[(4-methylcyclohexyl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
Chemical Structure Depiction of
N-[3-methyl-5-(2-{5-[(4-methylcyclohexyl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
N-[3-methyl-5-(2-{5-[(4-methylcyclohexyl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide
Compound characteristics
| Compound ID: | M331-0462 |
| Compound Name: | N-[3-methyl-5-(2-{5-[(4-methylcyclohexyl)sulfamoyl]thiophen-2-yl}ethenyl)-1,2-oxazol-4-yl]propanamide |
| Molecular Weight: | 437.58 |
| Molecular Formula: | C20 H27 N3 O4 S2 |
| Smiles: | CCC(Nc1c(C)noc1/C=C/c1ccc(s1)S(NC1CCC(C)CC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1023 |
| logD: | 4.102 |
| logSw: | -4.0049 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.223 |
| InChI Key: | ZWCMERNPNAZSPY-UHFFFAOYSA-N |