5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(4-ethylphenyl)-2-methylthiophene-3-sulfonamide
Chemical Structure Depiction of
5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(4-ethylphenyl)-2-methylthiophene-3-sulfonamide
5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(4-ethylphenyl)-2-methylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M333-0372 |
| Compound Name: | 5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(4-ethylphenyl)-2-methylthiophene-3-sulfonamide |
| Molecular Weight: | 375.51 |
| Molecular Formula: | C18 H21 N3 O2 S2 |
| Smiles: | CCc1ccc(cc1)NS(c1cc(c2c(C)c(C)n[nH]2)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7528 |
| logD: | 4.717 |
| logSw: | -4.4625 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.743 |
| InChI Key: | ARALUJGQLIOAIK-UHFFFAOYSA-N |