1-(5-chloro-2-methylphenyl)-4-[5-(3,4-dimethyl-1H-pyrazol-5-yl)-2-methylthiophene-3-sulfonyl]piperazine
Chemical Structure Depiction of
1-(5-chloro-2-methylphenyl)-4-[5-(3,4-dimethyl-1H-pyrazol-5-yl)-2-methylthiophene-3-sulfonyl]piperazine
1-(5-chloro-2-methylphenyl)-4-[5-(3,4-dimethyl-1H-pyrazol-5-yl)-2-methylthiophene-3-sulfonyl]piperazine
Compound characteristics
| Compound ID: | M333-0402 |
| Compound Name: | 1-(5-chloro-2-methylphenyl)-4-[5-(3,4-dimethyl-1H-pyrazol-5-yl)-2-methylthiophene-3-sulfonyl]piperazine |
| Molecular Weight: | 465.03 |
| Molecular Formula: | C21 H25 Cl N4 O2 S2 |
| Smiles: | Cc1ccc(cc1N1CCN(CC1)S(c1cc(c2c(C)c(C)n[nH]2)sc1C)(=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.1418 |
| logD: | 5.1196 |
| logSw: | -5.5323 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.764 |
| InChI Key: | BXAIOAWYDBRHDV-UHFFFAOYSA-N |