N-(2-methoxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]benzene-1-sulfonamide
N-(2-methoxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | M336-0525 |
| Compound Name: | N-(2-methoxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]benzene-1-sulfonamide |
| Molecular Weight: | 421.47 |
| Molecular Formula: | C22 H19 N3 O4 S |
| Smiles: | Cc1ccc(cc1)c1nc(c2ccccc2S(Nc2ccccc2OC)(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9727 |
| logD: | 4.5068 |
| logSw: | -4.6451 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.226 |
| InChI Key: | JZYWEHXAIURUIH-UHFFFAOYSA-N |