N-(3-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-2-(2-methylphenyl)acetamide
					Chemical Structure Depiction of
N-(3-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-2-(2-methylphenyl)acetamide
			N-(3-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-2-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | M339-1365 | 
| Compound Name: | N-(3-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-2-(2-methylphenyl)acetamide | 
| Molecular Weight: | 433.89 | 
| Molecular Formula: | C24 H20 Cl N3 O3 | 
| Smiles: | Cc1ccccc1CC(Nc1cccc(c1)OCc1nnc(c2ccc(cc2)[Cl])o1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.4552 | 
| logD: | 5.4551 | 
| logSw: | -5.9799 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 60.525 | 
| InChI Key: | PYTCVCSMECUYJC-UHFFFAOYSA-N | 
 
				 
				