2-(2-fluorophenyl)-N-{4-[(1H-1,2,4-triazol-1-yl)methyl]phenyl}acetamide
Chemical Structure Depiction of
2-(2-fluorophenyl)-N-{4-[(1H-1,2,4-triazol-1-yl)methyl]phenyl}acetamide
2-(2-fluorophenyl)-N-{4-[(1H-1,2,4-triazol-1-yl)methyl]phenyl}acetamide
Compound characteristics
| Compound ID: | M346-0132 |
| Compound Name: | 2-(2-fluorophenyl)-N-{4-[(1H-1,2,4-triazol-1-yl)methyl]phenyl}acetamide |
| Molecular Weight: | 310.33 |
| Molecular Formula: | C17 H15 F N4 O |
| Smiles: | C(C(Nc1ccc(Cn2cncn2)cc1)=O)c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 2.1342 |
| logD: | 2.1341 |
| logSw: | -2.6476 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.093 |
| InChI Key: | FYXYSJNGBFWKFE-UHFFFAOYSA-N |