N-[(2-chlorophenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
N-[(2-chlorophenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | M347-0248 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 493.05 |
| Molecular Formula: | C22 H25 Cl N4 O3 S2 |
| Smiles: | Cc1csc(c2cc(cn2CC(N2CCCCC2)=O)S(NCc2ccccc2[Cl])(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.7812 |
| logD: | 3.7806 |
| logSw: | -3.9607 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.412 |
| InChI Key: | CEEYDBUBHUALLP-UHFFFAOYSA-N |