N-cyclopentyl-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-cyclopentyl-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
N-cyclopentyl-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | M347-0255 |
| Compound Name: | N-cyclopentyl-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 436.59 |
| Molecular Formula: | C20 H28 N4 O3 S2 |
| Smiles: | Cc1csc(c2cc(cn2CC(N2CCCCC2)=O)S(NC2CCCC2)(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.9201 |
| logD: | 2.92 |
| logSw: | -3.3628 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.717 |
| InChI Key: | CDHSQAIEGWOXHW-UHFFFAOYSA-N |