N-[(2,5-dimethylphenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-[(2,5-dimethylphenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
N-[(2,5-dimethylphenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | M347-0400 |
| Compound Name: | N-[(2,5-dimethylphenyl)methyl]-5-(4-methyl-1,3-thiazol-2-yl)-1-[2-oxo-2-(piperidin-1-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 486.65 |
| Molecular Formula: | C24 H30 N4 O3 S2 |
| Smiles: | Cc1ccc(C)c(CNS(c2cc(c3nc(C)cs3)n(CC(N3CCCCC3)=O)c2)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.3145 |
| logD: | 4.3133 |
| logSw: | -3.9863 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.412 |
| InChI Key: | OTTOTEAXCYAWKX-UHFFFAOYSA-N |