N-(2-oxo-2-{4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]anilino}ethyl)benzamide
Chemical Structure Depiction of
N-(2-oxo-2-{4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]anilino}ethyl)benzamide
N-(2-oxo-2-{4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]anilino}ethyl)benzamide
Compound characteristics
| Compound ID: | M350-0001 |
| Compound Name: | N-(2-oxo-2-{4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxy]anilino}ethyl)benzamide |
| Molecular Weight: | 428.45 |
| Molecular Formula: | C24 H20 N4 O4 |
| Smiles: | C(C(Nc1ccc(cc1)OCc1nnc(c2ccccc2)o1)=O)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3795 |
| logD: | 3.3795 |
| logSw: | -3.5791 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.21 |
| InChI Key: | OSCIJTDMUXIWJD-UHFFFAOYSA-N |