N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-methylthiophene-2-carboxamide
Chemical Structure Depiction of
N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-methylthiophene-2-carboxamide
N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-methylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | M350-1240 |
| Compound Name: | N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-methylthiophene-2-carboxamide |
| Molecular Weight: | 425.89 |
| Molecular Formula: | C21 H16 Cl N3 O3 S |
| Smiles: | Cc1ccsc1C(Nc1ccc(cc1)OCc1nnc(c2ccc(cc2)[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7779 |
| logD: | 4.7778 |
| logSw: | -4.8397 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.757 |
| InChI Key: | HHVFGGHNHYTDQF-UHFFFAOYSA-N |