N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-(furan-2-yl)prop-2-enamide
Chemical Structure Depiction of
N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-(furan-2-yl)prop-2-enamide
N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-(furan-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | M350-1386 |
| Compound Name: | N-(4-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy}phenyl)-3-(furan-2-yl)prop-2-enamide |
| Molecular Weight: | 421.84 |
| Molecular Formula: | C22 H16 Cl N3 O4 |
| Smiles: | C(c1nnc(c2ccc(cc2)[Cl])o1)Oc1ccc(cc1)NC(/C=C/c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4006 |
| logD: | 4.4004 |
| logSw: | -4.7636 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.274 |
| InChI Key: | HLWDNNJZTRVMCJ-UHFFFAOYSA-N |