N-(3-fluoro-4-methylphenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3-fluoro-4-methylphenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
N-(3-fluoro-4-methylphenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M351-0102 |
| Compound Name: | N-(3-fluoro-4-methylphenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 382.5 |
| Molecular Formula: | C16 H15 F N2 O2 S3 |
| Smiles: | Cc1ccc(cc1F)NS(c1cc(c2csc(C)n2)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8976 |
| logD: | 4.4415 |
| logSw: | -4.6568 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.447 |
| InChI Key: | XKMHTWMGXOHVPW-UHFFFAOYSA-N |