N-(3-chloro-4-fluorophenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
N-(3-chloro-4-fluorophenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M351-0105 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-methyl-5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 402.91 |
| Molecular Formula: | C15 H12 Cl F N2 O2 S3 |
| Smiles: | Cc1c(cc(c2csc(C)n2)s1)S(Nc1ccc(c(c1)[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.978 |
| logD: | 3.0283 |
| logSw: | -5.1054 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.447 |
| InChI Key: | OURCXBKTLBGECX-UHFFFAOYSA-N |