2-(3-chloro-4-methoxyphenyl)-N-[2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophen-3-yl]acetamide
Chemical Structure Depiction of
2-(3-chloro-4-methoxyphenyl)-N-[2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophen-3-yl]acetamide
2-(3-chloro-4-methoxyphenyl)-N-[2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophen-3-yl]acetamide
Compound characteristics
| Compound ID: | M353-0172 |
| Compound Name: | 2-(3-chloro-4-methoxyphenyl)-N-[2-methyl-5-(4-methyl-1,3-thiazol-2-yl)thiophen-3-yl]acetamide |
| Molecular Weight: | 392.92 |
| Molecular Formula: | C18 H17 Cl N2 O2 S2 |
| Smiles: | Cc1csc(c2cc(c(C)s2)NC(Cc2ccc(c(c2)[Cl])OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.4578 |
| logD: | 4.4577 |
| logSw: | -4.4873 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.607 |
| InChI Key: | WGXJGIMPZANNDJ-UHFFFAOYSA-N |