3-ethyl-6-[5-(3-methylthiophen-2-yl)-1,2,4-oxadiazol-3-yl]-1,3-benzoxazol-2(3H)-one
Chemical Structure Depiction of
3-ethyl-6-[5-(3-methylthiophen-2-yl)-1,2,4-oxadiazol-3-yl]-1,3-benzoxazol-2(3H)-one
3-ethyl-6-[5-(3-methylthiophen-2-yl)-1,2,4-oxadiazol-3-yl]-1,3-benzoxazol-2(3H)-one
Compound characteristics
| Compound ID: | M355-0290 |
| Compound Name: | 3-ethyl-6-[5-(3-methylthiophen-2-yl)-1,2,4-oxadiazol-3-yl]-1,3-benzoxazol-2(3H)-one |
| Molecular Weight: | 327.36 |
| Molecular Formula: | C16 H13 N3 O3 S |
| Smiles: | CCN1C(=O)Oc2cc(ccc12)c1nc(c2c(C)ccs2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.1909 |
| logD: | 4.1909 |
| logSw: | -4.349 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.487 |
| InChI Key: | RUWRPZLHZJLCDZ-UHFFFAOYSA-N |