N-cyclopentyl-4-{[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl]methyl}benzamide
Chemical Structure Depiction of
N-cyclopentyl-4-{[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl]methyl}benzamide
N-cyclopentyl-4-{[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl]methyl}benzamide
Compound characteristics
| Compound ID: | M358-0699 |
| Compound Name: | N-cyclopentyl-4-{[3,5-dimethyl-4-(4-methylpiperidine-1-sulfonyl)-1H-pyrazol-1-yl]methyl}benzamide |
| Molecular Weight: | 458.62 |
| Molecular Formula: | C24 H34 N4 O3 S |
| Smiles: | CC1CCN(CC1)S(c1c(C)nn(Cc2ccc(cc2)C(NC2CCCC2)=O)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9585 |
| logD: | 2.9585 |
| logSw: | -3.4397 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.736 |
| InChI Key: | HHUZBHFURKBZJD-UHFFFAOYSA-N |