2-methyl-N-[2-(methylsulfanyl)phenyl]-6-[(morpholin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Chemical Structure Depiction of
2-methyl-N-[2-(methylsulfanyl)phenyl]-6-[(morpholin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
2-methyl-N-[2-(methylsulfanyl)phenyl]-6-[(morpholin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Compound characteristics
| Compound ID: | M372-0724 |
| Compound Name: | 2-methyl-N-[2-(methylsulfanyl)phenyl]-6-[(morpholin-4-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| Molecular Weight: | 401.55 |
| Molecular Formula: | C20 H23 N3 O2 S2 |
| Smiles: | Cc1cc2c(c(CN3CCOCC3)c(C(Nc3ccccc3SC)=O)[nH]2)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.5468 |
| logD: | 2.0748 |
| logSw: | -3.7914 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.411 |
| InChI Key: | WWWNNQSNRNOTIS-UHFFFAOYSA-N |