N-(2-methoxyethyl)-1-methyl-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-1-methyl-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
N-(2-methoxyethyl)-1-methyl-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
Compound characteristics
| Compound ID: | M379-0175 |
| Compound Name: | N-(2-methoxyethyl)-1-methyl-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide |
| Molecular Weight: | 287.36 |
| Molecular Formula: | C16 H21 N3 O2 |
| Smiles: | Cn1cc2CCN(Cc3cccc1c23)C(NCCOC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9456 |
| logD: | 1.9456 |
| logSw: | -2.4499 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.038 |
| InChI Key: | OYVVXTANZVMPHR-UHFFFAOYSA-N |