1-methyl-N-(2-methylphenyl)-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
Chemical Structure Depiction of
1-methyl-N-(2-methylphenyl)-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
1-methyl-N-(2-methylphenyl)-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide
Compound characteristics
| Compound ID: | M379-0299 |
| Compound Name: | 1-methyl-N-(2-methylphenyl)-1,3,4,6-tetrahydro-5H-azepino[5,4,3-cd]indole-5-carboxamide |
| Molecular Weight: | 319.4 |
| Molecular Formula: | C20 H21 N3 O |
| Smiles: | Cc1ccccc1NC(N1CCc2cn(C)c3cccc(C1)c23)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5332 |
| logD: | 3.5332 |
| logSw: | -3.6235 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.5621 |
| InChI Key: | MXVSMPSAGWBMIC-UHFFFAOYSA-N |